C16H22O2Si — CID 102357618
(8S)-5-methoxy-1,8-dimethyl-1-silatricyclo[6.5.1.02,7]tetradeca-2(7),3,5-trien-10-one (PubChem CID 102357618) has the molecular formula C16H22O2Si and a molecular weight of 274.44 g/mol. Its IUPAC name is (8S)-5-methoxy-1,8-dimethyl-1-silatricyclo[6.5.1.02,7]tetradeca-2(7),3,5-trien-10-one.
| Compound Name | (8S)-5-methoxy-1,8-dimethyl-1-silatricyclo[6.5.1.02,7]tetradeca-2(7),3,5-trien-10-one |
|---|---|
| PubChem CID | 102357618 |
| Molecular Formula | C16H22O2Si |
| Molecular Weight | 274.44 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | (8S)-5-methoxy-1,8-dimethyl-1-silatricyclo[6.5.1.02,7]tetradeca-2(7),3,5-trien-10-one |
| SMILES | COc1ccc2c(c1)[C@]1(C)CC(=O)CCC[Si]2(C)C1 |
| InChI | InChI=1S/C16H22O2Si/c1-16-10-12(17)5-4-8-19(3,11-16)15-7-6-13(18-2)9-14(15)16/h6-7,9H,4-5,8,10-11H2,1-3H3/t16-,19?/m1/s1 |
| InChIKey | RGGWPCZQRZEICN-VTBWFHPJSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.44 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|