C12H12O3 — CID 142704894
3,7-dimethoxy-1H-naphthalen-2-one (PubChem CID 142704894) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 3,7-dimethoxy-1H-naphthalen-2-one.
| Compound Name | 3,7-dimethoxy-1H-naphthalen-2-one |
|---|---|
| PubChem CID | 142704894 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3,7-dimethoxy-1H-naphthalen-2-one |
| SMILES | COC1=Cc2ccc(OC)cc2CC1=O |
| InChI | InChI=1S/C12H12O3/c1-14-10-4-3-8-7-12(15-2)11(13)6-9(8)5-10/h3-5,7H,6H2,1-2H3 |
| InChIKey | HZXRTJADXSOIKE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |