C13H16O2 — CID 143787705
2,6-dimethoxy-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 143787705) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is 2,6-dimethoxy-8,9-dihydro-7H-benzo[7]annulene.
| Compound Name | 2,6-dimethoxy-8,9-dihydro-7H-benzo[7]annulene |
|---|---|
| PubChem CID | 143787705 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | 2,6-dimethoxy-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | COC1=Cc2ccc(OC)cc2CCC1 |
| InChI | InChI=1S/C13H16O2/c1-14-12-5-3-4-10-8-13(15-2)7-6-11(10)9-12/h6-9H,3-5H2,1-2H3 |
| InChIKey | UWHAPYGMUFIHOX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |