C14H20N2O — CID 10681104
3-(6-methoxy-3,4-dihydronaphthalen-2-yl)propane-1,2-diamine (PubChem CID 10681104) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 3-(6-methoxy-3,4-dihydronaphthalen-2-yl)propane-1,2-diamine.
| Compound Name | 3-(6-methoxy-3,4-dihydronaphthalen-2-yl)propane-1,2-diamine |
|---|---|
| PubChem CID | 10681104 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 3-(6-methoxy-3,4-dihydronaphthalen-2-yl)propane-1,2-diamine |
| SMILES | COc1ccc2c(c1)CCC(CC(N)CN)=C2 |
| InChI | InChI=1S/C14H20N2O/c1-17-14-5-4-11-6-10(7-13(16)9-15)2-3-12(11)8-14/h4-6,8,13H,2-3,7,9,15-16H2,1H3 |
| InChIKey | QLDTUYDSRRMINB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |