C14H18N2O2 — CID 152747543
1-(6-methoxy-3,4-dihydronaphthalen-2-yl)ethylurea (PubChem CID 152747543) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-(6-methoxy-3,4-dihydronaphthalen-2-yl)ethylurea.
| Compound Name | 1-(6-methoxy-3,4-dihydronaphthalen-2-yl)ethylurea |
|---|---|
| PubChem CID | 152747543 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-(6-methoxy-3,4-dihydronaphthalen-2-yl)ethylurea |
| SMILES | COc1ccc2c(c1)CCC(C(C)NC(N)=O)=C2 |
| InChI | InChI=1S/C14H18N2O2/c1-9(16-14(15)17)10-3-4-12-8-13(18-2)6-5-11(12)7-10/h5-9H,3-4H2,1-2H3,(H3,15,16,17) |
| InChIKey | MFOJAAINTCVTBW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |