C12H15NO3 — CID 83910529
methyl 1-amino-5-methoxy-2,3-dihydroindene-1-carboxylate (PubChem CID 83910529) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is methyl 1-amino-5-methoxy-2,3-dihydroindene-1-carboxylate.
| Compound Name | methyl 1-amino-5-methoxy-2,3-dihydroindene-1-carboxylate |
|---|---|
| PubChem CID | 83910529 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | methyl 1-amino-5-methoxy-2,3-dihydroindene-1-carboxylate |
| SMILES | COC(=O)C1(N)CCc2cc(OC)ccc21 |
| InChI | InChI=1S/C12H15NO3/c1-15-9-3-4-10-8(7-9)5-6-12(10,13)11(14)16-2/h3-4,7H,5-6,13H2,1-2H3 |
| InChIKey | BMTGWFTUWAUKIK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |