methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate

C11H13NO2 — CID 67850264

IUPACmethyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate
SMILESCOC(=O)[C@@]1(N)CCc2ccccc21
InChIInChI=1S/C11H13NO2/c1-14-10(13)11(12)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7,12H2,1H3/t11-/m1/s1
InChIKeyLMEYOVHVNJPYHW-LLVKDONJSA-N
MW191.23 g/mol
LogP0.96
Rot. Bonds1

About methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate

methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate (PubChem CID 67850264) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate.

Molecular Properties

Compound Namemethyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate
PubChem CID67850264
Molecular FormulaC11H13NO2
Molecular Weight191.23 g/mol
Exact Mass191.09
IUPAC Namemethyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate
SMILESCOC(=O)[C@@]1(N)CCc2ccccc21
InChIInChI=1S/C11H13NO2/c1-14-10(13)11(12)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7,12H2,1H3/t11-/m1/s1
InChIKeyLMEYOVHVNJPYHW-LLVKDONJSA-N
XLogP0.96
TPSA52.32 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 50.96
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate?
The IUPAC name of methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate (CID 67850264) is methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate.
What is the SMILES notation for methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate?
The canonical SMILES for methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate is COC(=O)[C@@]1(N)CCc2ccccc21.
What is the InChIKey of methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate?
The InChIKey is LMEYOVHVNJPYHW-LLVKDONJSA-N. The full InChI is InChI=1S/C11H13NO2/c1-14-10(13)11(12)7-6-8-4-2-3-5-9(8)11/h2-5H,6-7,12H2,1H3/t11-/m1/s1.
What are the key properties of methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate?
methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate has a molecular weight of 191.23 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1R)-1-amino-2,3-dihydroindene-1-carboxylate is sourced from PubChem (CID 67850264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).