C12H16O — CID 22152285
6-methoxy-3,3-dimethyl-1,2-dihydroindene (PubChem CID 22152285) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-methoxy-3,3-dimethyl-1,2-dihydroindene.
| Compound Name | 6-methoxy-3,3-dimethyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 22152285 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 6-methoxy-3,3-dimethyl-1,2-dihydroindene |
| SMILES | COc1ccc2c(c1)CCC2(C)C |
| InChI | InChI=1S/C12H16O/c1-12(2)7-6-9-8-10(13-3)4-5-11(9)12/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | DVIQJHKQDUMLBP-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |