C11H13FO — CID 84718386
3-fluoro-6-methoxy-3-methyl-1,2-dihydroindene (PubChem CID 84718386) has the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. Its IUPAC name is 3-fluoro-6-methoxy-3-methyl-1,2-dihydroindene.
| Compound Name | 3-fluoro-6-methoxy-3-methyl-1,2-dihydroindene |
|---|---|
| PubChem CID | 84718386 |
| Molecular Formula | C11H13FO |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 3-fluoro-6-methoxy-3-methyl-1,2-dihydroindene |
| SMILES | COc1ccc2c(c1)CCC2(C)F |
| InChI | InChI=1S/C11H13FO/c1-11(12)6-5-8-7-9(13-2)3-4-10(8)11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | ZWFHFURFZDYQSL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |