C12H16INO — CID 67206648
5-iodo-8-methoxy-5-methyl-1,2,3,4-tetrahydro-3-benzazepine (PubChem CID 67206648) has the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. Its IUPAC name is 5-iodo-8-methoxy-5-methyl-1,2,3,4-tetrahydro-3-benzazepine.
| Compound Name | 5-iodo-8-methoxy-5-methyl-1,2,3,4-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 67206648 |
| Molecular Formula | C12H16INO |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 5-iodo-8-methoxy-5-methyl-1,2,3,4-tetrahydro-3-benzazepine |
| SMILES | COc1ccc2c(c1)CCNCC2(C)I |
| InChI | InChI=1S/C12H16INO/c1-12(13)8-14-6-5-9-7-10(15-2)3-4-11(9)12/h3-4,7,14H,5-6,8H2,1-2H3 |
| InChIKey | RKKQQFZJRNBHPK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|