About 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine]
6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] (PubChem CID 84620045) has the molecular formula C13H17NO
and a molecular weight of 203.29 g/mol. Its IUPAC name is 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine].
Molecular Properties
| Compound Name | 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] |
| PubChem CID | 84620045 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] |
| SMILES | COc1ccc2c(c1)CC1(CC2)CNC1 |
| InChI | InChI=1S/C13H17NO/c1-15-12-3-2-10-4-5-13(8-14-9-13)7-11(10)6-12/h2-3,6,14H,4-5,7-9H2,1H3 |
| InChIKey | DJWHESSTXJAPKW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine]?
The IUPAC name of 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] (CID 84620045) is 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine].
What is the SMILES notation for 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine]?
The canonical SMILES for 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] is COc1ccc2c(c1)CC1(CC2)CNC1.
What is the InChIKey of 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine]?
The InChIKey is DJWHESSTXJAPKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO/c1-15-12-3-2-10-4-5-13(8-14-9-13)7-11(10)6-12/h2-3,6,14H,4-5,7-9H2,1H3.
What are the key properties of 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine]?
6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] has a molecular weight of 203.29 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyspiro[2,4-dihydro-1H-naphthalene-3,3'-azetidine] is sourced from PubChem (CID 84620045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).