C18H16F2O5S — CID 60606725
(3-methoxyphenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate (PubChem CID 60606725) has the molecular formula C18H16F2O5S and a molecular weight of 382.38 g/mol. Its IUPAC name is (3-methoxyphenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate.
| Compound Name | (3-methoxyphenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 60606725 |
| Molecular Formula | C18H16F2O5S |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | (3-methoxyphenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate |
| SMILES | COc1cccc(OS(=O)(=O)C2=Cc3ccc(OC(F)F)cc3CC2)c1 |
| InChI | InChI=1S/C18H16F2O5S/c1-23-14-3-2-4-16(11-14)25-26(21,22)17-8-6-12-9-15(24-18(19)20)7-5-13(12)10-17/h2-5,7,9-11,18H,6,8H2,1H3 |
| InChIKey | ZEAOZYKVXPVUDL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|