C17H13F3O4S — CID 60606782
(2-fluorophenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate (PubChem CID 60606782) has the molecular formula C17H13F3O4S and a molecular weight of 370.35 g/mol. Its IUPAC name is (2-fluorophenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate.
| Compound Name | (2-fluorophenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate |
|---|---|
| PubChem CID | 60606782 |
| Molecular Formula | C17H13F3O4S |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.05 |
| IUPAC Name | (2-fluorophenyl) 6-(difluoromethoxy)-3,4-dihydronaphthalene-2-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1F)C1=Cc2ccc(OC(F)F)cc2CC1 |
| InChI | InChI=1S/C17H13F3O4S/c18-15-3-1-2-4-16(15)24-25(21,22)14-8-6-11-9-13(23-17(19)20)7-5-12(11)10-14/h1-5,7,9-10,17H,6,8H2 |
| InChIKey | ZJMDXHFMPHAKGN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|