C16H14FNO — CID 151333084
6-(2-fluorophenoxy)-2-methyl-3,4-dihydroquinoline (PubChem CID 151333084) has the molecular formula C16H14FNO and a molecular weight of 255.29 g/mol. Its IUPAC name is 6-(2-fluorophenoxy)-2-methyl-3,4-dihydroquinoline.
| Compound Name | 6-(2-fluorophenoxy)-2-methyl-3,4-dihydroquinoline |
|---|---|
| PubChem CID | 151333084 |
| Molecular Formula | C16H14FNO |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 6-(2-fluorophenoxy)-2-methyl-3,4-dihydroquinoline |
| SMILES | CC1=Nc2ccc(Oc3ccccc3F)cc2CC1 |
| InChI | InChI=1S/C16H14FNO/c1-11-6-7-12-10-13(8-9-15(12)18-11)19-16-5-3-2-4-14(16)17/h2-5,8-10H,6-7H2,1H3 |
| InChIKey | OIWINJVJFSNVPY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |