C15H20O2 — CID 143846492
7-methoxy-3-(1-methoxypropyl)-1,2-dihydronaphthalene (PubChem CID 143846492) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 7-methoxy-3-(1-methoxypropyl)-1,2-dihydronaphthalene.
| Compound Name | 7-methoxy-3-(1-methoxypropyl)-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 143846492 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 7-methoxy-3-(1-methoxypropyl)-1,2-dihydronaphthalene |
| SMILES | CCC(OC)C1=Cc2ccc(OC)cc2CC1 |
| InChI | InChI=1S/C15H20O2/c1-4-15(17-3)13-6-5-12-10-14(16-2)8-7-11(12)9-13/h7-10,15H,4-6H2,1-3H3 |
| InChIKey | PMMWECGTLNOUCV-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |