C19H20O3 — CID 57081453
3-(2,4-dimethoxyphenyl)-7-methoxy-1,2-dihydronaphthalene (PubChem CID 57081453) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(2,4-dimethoxyphenyl)-7-methoxy-1,2-dihydronaphthalene.
| Compound Name | 3-(2,4-dimethoxyphenyl)-7-methoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 57081453 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3-(2,4-dimethoxyphenyl)-7-methoxy-1,2-dihydronaphthalene |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(OC)cc1OC)=C2 |
| InChI | InChI=1S/C19H20O3/c1-20-16-7-6-13-10-15(5-4-14(13)11-16)18-9-8-17(21-2)12-19(18)22-3/h6-12H,4-5H2,1-3H3 |
| InChIKey | ORVLIQAMHNFOJE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|