C18H16ClFO2 — CID 54050552
3-(2-chloro-4-fluoro-3-methoxyphenyl)-7-methoxy-1,2-dihydronaphthalene (PubChem CID 54050552) has the molecular formula C18H16ClFO2 and a molecular weight of 318.78 g/mol. Its IUPAC name is 3-(2-chloro-4-fluoro-3-methoxyphenyl)-7-methoxy-1,2-dihydronaphthalene.
| Compound Name | 3-(2-chloro-4-fluoro-3-methoxyphenyl)-7-methoxy-1,2-dihydronaphthalene |
|---|---|
| PubChem CID | 54050552 |
| Molecular Formula | C18H16ClFO2 |
| Molecular Weight | 318.78 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 3-(2-chloro-4-fluoro-3-methoxyphenyl)-7-methoxy-1,2-dihydronaphthalene |
| SMILES | COc1ccc2c(c1)CCC(c1ccc(F)c(OC)c1Cl)=C2 |
| InChI | InChI=1S/C18H16ClFO2/c1-21-14-6-5-11-9-13(4-3-12(11)10-14)15-7-8-16(20)18(22-2)17(15)19/h5-10H,3-4H2,1-2H3 |
| InChIKey | LXQVMUSBLYBKKG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.78 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|