C17H13ClO2 — CID 150256933
3-chloro-8-methoxy-5a,6-dihydronaphtho[2,3-b][1]benzofuran (PubChem CID 150256933) has the molecular formula C17H13ClO2 and a molecular weight of 284.74 g/mol. Its IUPAC name is 3-chloro-8-methoxy-5a,6-dihydronaphtho[2,3-b][1]benzofuran.
| Compound Name | 3-chloro-8-methoxy-5a,6-dihydronaphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 150256933 |
| Molecular Formula | C17H13ClO2 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-chloro-8-methoxy-5a,6-dihydronaphtho[2,3-b][1]benzofuran |
| SMILES | COc1ccc2c(c1)CC1Oc3cc(Cl)ccc3C1=C2 |
| InChI | InChI=1S/C17H13ClO2/c1-19-13-4-2-10-7-15-14-5-3-12(18)9-17(14)20-16(15)8-11(10)6-13/h2-7,9,16H,8H2,1H3 |
| InChIKey | GATGHRAGVNYKGB-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|