C13H12O3 — CID 139067197
(3aR)-7-methoxy-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one (PubChem CID 139067197) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is (3aR)-7-methoxy-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one.
| Compound Name | (3aR)-7-methoxy-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one |
|---|---|
| PubChem CID | 139067197 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (3aR)-7-methoxy-3,3a-dihydro-2H-cyclopenta[b]chromen-1-one |
| SMILES | COc1ccc2c(c1)C=C1C(=O)CC[C@H]1O2 |
| InChI | InChI=1S/C13H12O3/c1-15-9-2-4-12-8(6-9)7-10-11(14)3-5-13(10)16-12/h2,4,6-7,13H,3,5H2,1H3/t13-/m1/s1 |
| InChIKey | DRFBDDSDEDBTFK-CYBMUJFWSA-N |
| XLogP | 2.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |