C18H18O5 — CID 2922801
2-(3,4-dimethoxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one (PubChem CID 2922801) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 2922801 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CC(c1ccc(OC)c(OC)c1)O2 |
| InChI | InChI=1S/C18H18O5/c1-20-12-5-7-15-13(9-12)14(19)10-17(23-15)11-4-6-16(21-2)18(8-11)22-3/h4-9,17H,10H2,1-3H3 |
| InChIKey | KYRMOZFTJMQBFZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |