C16H14O6 — CID 102145698
(2R)-2-(3,4-dihydroxyphenyl)-6-hydroxy-7-methoxy-2,3-dihydrochromen-4-one (PubChem CID 102145698) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydroxyphenyl)-6-hydroxy-7-methoxy-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-2-(3,4-dihydroxyphenyl)-6-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 102145698 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2R)-2-(3,4-dihydroxyphenyl)-6-hydroxy-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(cc1O)C(=O)C[C@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C16H14O6/c1-21-16-7-15-9(5-13(16)20)11(18)6-14(22-15)8-2-3-10(17)12(19)4-8/h2-5,7,14,17,19-20H,6H2,1H3/t14-/m1/s1 |
| InChIKey | RPRQFMAGEYDILE-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|