C17H16O6 — CID 163064511
(2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 163064511) has the molecular formula C17H16O6 and a molecular weight of 316.31 g/mol. Its IUPAC name is (2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-methyl-2,3-dihydrochromen-4-one.
| Compound Name | (2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-methyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 163064511 |
| Molecular Formula | C17H16O6 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (2R)-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-methoxy-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(c(O)c1C)C(=O)C[C@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C17H16O6/c1-8-13(22-2)7-15-16(17(8)21)12(20)6-14(23-15)9-3-4-10(18)11(19)5-9/h3-5,7,14,18-19,21H,6H2,1-2H3/t14-/m1/s1 |
| InChIKey | DHFNKQLCKYISKC-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|