C16H13ClO3 — CID 12073467
6-chloro-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 12073467) has the molecular formula C16H13ClO3 and a molecular weight of 288.73 g/mol. Its IUPAC name is 6-chloro-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 6-chloro-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 12073467 |
| Molecular Formula | C16H13ClO3 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | 6-chloro-7-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | COc1cc2c(cc1Cl)C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C16H13ClO3/c1-19-16-9-15-11(7-12(16)17)13(18)8-14(20-15)10-5-3-2-4-6-10/h2-7,9,14H,8H2,1H3 |
| InChIKey | PYPPLLIWZBNXMB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |