C17H16O4 — CID 24978119
6,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one (PubChem CID 24978119) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 6,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one.
| Compound Name | 6,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|---|
| PubChem CID | 24978119 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 6,8-dimethoxy-2-phenyl-2,3-dihydrochromen-4-one |
| SMILES | COc1cc(OC)c2c(c1)C(=O)CC(c1ccccc1)O2 |
| InChI | InChI=1S/C17H16O4/c1-19-12-8-13-14(18)10-15(11-6-4-3-5-7-11)21-17(13)16(9-12)20-2/h3-9,15H,10H2,1-2H3 |
| InChIKey | YDSZINANHNKXEM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |