C20H15F3O2 — CID 130392127
(3S)-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene (PubChem CID 130392127) has the molecular formula C20H15F3O2 and a molecular weight of 344.33 g/mol. Its IUPAC name is (3S)-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene.
| Compound Name | (3S)-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 130392127 |
| Molecular Formula | C20H15F3O2 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (3S)-9-methoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene |
| SMILES | COc1ccc2ccc3c(c2c1)CC[C@@H](c1cc(F)c(F)cc1F)O3 |
| InChI | InChI=1S/C20H15F3O2/c1-24-12-4-2-11-3-6-19-13(14(11)8-12)5-7-20(25-19)15-9-17(22)18(23)10-16(15)21/h2-4,6,8-10,20H,5,7H2,1H3/t20-/m0/s1 |
| InChIKey | LGEUGOXBJIHSDG-FQEVSTJZSA-N |
| XLogP | 5.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|