C20H17BrF3NO — CID 145071217
9-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene;methanamine (PubChem CID 145071217) has the molecular formula C20H17BrF3NO and a molecular weight of 424.26 g/mol. Its IUPAC name is 9-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene;methanamine.
| Compound Name | 9-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene;methanamine |
|---|---|
| PubChem CID | 145071217 |
| Molecular Formula | C20H17BrF3NO |
| Molecular Weight | 424.26 g/mol |
| Exact Mass | 423.04 |
| IUPAC Name | 9-bromo-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene;methanamine |
| SMILES | CN.Fc1cc(F)c(C2CCc3c(ccc4ccc(Br)cc34)O2)cc1F |
| InChI | InChI=1S/C19H12BrF3O.CH5N/c20-11-3-1-10-2-5-18-12(13(10)7-11)4-6-19(24-18)14-8-16(22)17(23)9-15(14)21;1-2/h1-3,5,7-9,19H,4,6H2;2H2,1H3 |
| InChIKey | QQWDEKZBWBTGGZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.26 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|