C21H17F3O3 — CID 130392084
(3S)-8,9-dimethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene (PubChem CID 130392084) has the molecular formula C21H17F3O3 and a molecular weight of 374.36 g/mol. Its IUPAC name is (3S)-8,9-dimethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene.
| Compound Name | (3S)-8,9-dimethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 130392084 |
| Molecular Formula | C21H17F3O3 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (3S)-8,9-dimethoxy-3-(2,4,5-trifluorophenyl)-2,3-dihydro-1H-benzo[f]chromene |
| SMILES | COc1cc2ccc3c(c2cc1OC)CC[C@@H](c1cc(F)c(F)cc1F)O3 |
| InChI | InChI=1S/C21H17F3O3/c1-25-20-7-11-3-5-18-12(13(11)9-21(20)26-2)4-6-19(27-18)14-8-16(23)17(24)10-15(14)22/h3,5,7-10,19H,4,6H2,1-2H3/t19-/m0/s1 |
| InChIKey | BFFQBVQHAIDVRO-IBGZPJMESA-N |
| XLogP | 5.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|