C23H21F2NO5 — CID 145071205
3-(2,4-difluorophenyl)-8,9-dimethoxy-2-nitro-3H-benzo[f]chromene;ethane (PubChem CID 145071205) has the molecular formula C23H21F2NO5 and a molecular weight of 429.42 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-8,9-dimethoxy-2-nitro-3H-benzo[f]chromene;ethane.
| Compound Name | 3-(2,4-difluorophenyl)-8,9-dimethoxy-2-nitro-3H-benzo[f]chromene;ethane |
|---|---|
| PubChem CID | 145071205 |
| Molecular Formula | C23H21F2NO5 |
| Molecular Weight | 429.42 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 3-(2,4-difluorophenyl)-8,9-dimethoxy-2-nitro-3H-benzo[f]chromene;ethane |
| SMILES | CC.COc1cc2ccc3c(c2cc1OC)C=C([N+](=O)[O-])C(c1ccc(F)cc1F)O3 |
| InChI | InChI=1S/C21H15F2NO5.C2H6/c1-27-19-7-11-3-6-18-15(14(11)10-20(19)28-2)9-17(24(25)26)21(29-18)13-5-4-12(22)8-16(13)23;1-2/h3-10,21H,1-2H3;1-2H3 |
| InChIKey | BXOCKRJMGNDJRW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.42 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|