C16H17NO5 — CID 145071214
8,9-dimethoxy-3-methyl-2-nitro-2,3-dihydro-1H-benzo[f]chromene (PubChem CID 145071214) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 8,9-dimethoxy-3-methyl-2-nitro-2,3-dihydro-1H-benzo[f]chromene.
| Compound Name | 8,9-dimethoxy-3-methyl-2-nitro-2,3-dihydro-1H-benzo[f]chromene |
|---|---|
| PubChem CID | 145071214 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 8,9-dimethoxy-3-methyl-2-nitro-2,3-dihydro-1H-benzo[f]chromene |
| SMILES | COc1cc2ccc3c(c2cc1OC)CC([N+](=O)[O-])C(C)O3 |
| InChI | InChI=1S/C16H17NO5/c1-9-13(17(18)19)7-12-11-8-16(21-3)15(20-2)6-10(11)4-5-14(12)22-9/h4-6,8-9,13H,7H2,1-3H3 |
| InChIKey | RTLSRKHLEKISSB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|