C18H21NO2 — CID 14145926
(11aR)-2,3-dimethoxy-7,9,10,11,11a,12-hexahydronaphtho[2,1-f]indolizine (PubChem CID 14145926) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (11aR)-2,3-dimethoxy-7,9,10,11,11a,12-hexahydronaphtho[2,1-f]indolizine.
| Compound Name | (11aR)-2,3-dimethoxy-7,9,10,11,11a,12-hexahydronaphtho[2,1-f]indolizine |
|---|---|
| PubChem CID | 14145926 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (11aR)-2,3-dimethoxy-7,9,10,11,11a,12-hexahydronaphtho[2,1-f]indolizine |
| SMILES | COc1cc2ccc3c(c2cc1OC)C[C@H]1CCCN1C3 |
| InChI | InChI=1S/C18H21NO2/c1-20-17-8-12-5-6-13-11-19-7-3-4-14(19)9-15(13)16(12)10-18(17)21-2/h5-6,8,10,14H,3-4,7,9,11H2,1-2H3/t14-/m1/s1 |
| InChIKey | YXENMVITHJQZQO-CQSZACIVSA-N |
| XLogP | 3.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |