C25H29NO5 — CID 163021537
(13aR)-2,3,4,6,7-pentamethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine (PubChem CID 163021537) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (13aR)-2,3,4,6,7-pentamethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine.
| Compound Name | (13aR)-2,3,4,6,7-pentamethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
|---|---|
| PubChem CID | 163021537 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (13aR)-2,3,4,6,7-pentamethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| SMILES | COc1cc2c3c(c4cc(OC)c(OC)c(OC)c4c2cc1OC)C[C@H]1CCCN1C3 |
| InChI | InChI=1S/C25H29NO5/c1-27-20-10-16-17(11-21(20)28-2)23-18(12-22(29-3)24(30-4)25(23)31-5)15-9-14-7-6-8-26(14)13-19(15)16/h10-12,14H,6-9,13H2,1-5H3/t14-/m1/s1 |
| InChIKey | MBPWXIIJEVGZKP-CQSZACIVSA-N |
| XLogP | 4.56 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|