C25H29NO5 — CID 129175480
[3,4-bis(hydroxymethyl)-2,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol (PubChem CID 129175480) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is [3,4-bis(hydroxymethyl)-2,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol.
| Compound Name | [3,4-bis(hydroxymethyl)-2,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol |
|---|---|
| PubChem CID | 129175480 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [3,4-bis(hydroxymethyl)-2,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol |
| SMILES | COc1cc2c3c(c4cc(OC)c(CO)c(CO)c4c2cc1CO)CC1CCCN1C3 |
| InChI | InChI=1S/C25H29NO5/c1-30-23-8-17-18(6-14(23)11-27)25-19(9-24(31-2)21(12-28)22(25)13-29)16-7-15-4-3-5-26(15)10-20(16)17/h6,8-9,15,27-29H,3-5,7,10-13H2,1-2H3 |
| InChIKey | VEHNUEHHQQICFK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 82.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|