C24H27NO4 — CID 129175488
(13R,14aS)-3,6-bis(hydroxymethyl)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizin-13-ol (PubChem CID 129175488) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is (13R,14aS)-3,6-bis(hydroxymethyl)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizin-13-ol.
| Compound Name | (13R,14aS)-3,6-bis(hydroxymethyl)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizin-13-ol |
|---|---|
| PubChem CID | 129175488 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | (13R,14aS)-3,6-bis(hydroxymethyl)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[9,10-b]quinolizin-13-ol |
| SMILES | COc1cc2c3c(c4ccc(CO)cc4c2cc1CO)CN1CC[C@@H](O)C[C@@H]1C3 |
| InChI | InChI=1S/C24H27NO4/c1-29-24-10-22-20(7-15(24)13-27)19-6-14(12-26)2-3-18(19)23-11-25-5-4-17(28)8-16(25)9-21(22)23/h2-3,6-7,10,16-17,26-28H,4-5,8-9,11-13H2,1H3/t16-,17-/m1/s1 |
| InChIKey | CONWSUJOVSWKJL-IAGOWNOFSA-N |
| XLogP | 2.87 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|