C22H24N2O2 — CID 58399034
[(13aS)-3-amino-7-methoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol (PubChem CID 58399034) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is [(13aS)-3-amino-7-methoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol.
| Compound Name | [(13aS)-3-amino-7-methoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol |
|---|---|
| PubChem CID | 58399034 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | [(13aS)-3-amino-7-methoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]methanol |
| SMILES | COc1cc2c3c(c4ccc(N)cc4c2cc1CO)C[C@@H]1CCCN1C3 |
| InChI | InChI=1S/C22H24N2O2/c1-26-22-10-20-17(7-13(22)12-25)18-8-14(23)4-5-16(18)19-9-15-3-2-6-24(15)11-21(19)20/h4-5,7-8,10,15,25H,2-3,6,9,11-12,23H2,1H3/t15-/m0/s1 |
| InChIKey | BHQVAAWFCLYRLM-HNNXBMFYSA-N |
| XLogP | 3.60 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|