C26H27NO4 — CID 162665781
[(13aS)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] cyclopropanecarboxylate (PubChem CID 162665781) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is [(13aS)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] cyclopropanecarboxylate.
| Compound Name | [(13aS)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 162665781 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(13aS)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl] cyclopropanecarboxylate |
| SMILES | COc1cc2c3c(c4ccc(OC(=O)C5CC5)cc4c2cc1OC)CN1CCC[C@H]1C3 |
| InChI | InChI=1S/C26H27NO4/c1-29-24-12-21-19-10-16-4-3-9-27(16)14-23(19)18-8-7-17(31-26(28)15-5-6-15)11-20(18)22(21)13-25(24)30-2/h7-8,11-13,15-16H,3-6,9-10,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | JYVGKDJHOWULIP-INIZCTEOSA-N |
| XLogP | 4.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|