C23H26N2O4S — CID 46187498
N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]methanesulfonamide (PubChem CID 46187498) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]methanesulfonamide.
| Compound Name | N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 46187498 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]methanesulfonamide |
| SMILES | COc1cc2c3c(c4ccc(NS(C)(=O)=O)cc4c2cc1OC)C[C@@H]1CCCN1C3 |
| InChI | InChI=1S/C23H26N2O4S/c1-28-22-11-19-17-9-14(24-30(3,26)27)6-7-16(17)18-10-15-5-4-8-25(15)13-21(18)20(19)12-23(22)29-2/h6-7,9,11-12,15,24H,4-5,8,10,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | QXVBXIYOWXJTLB-HNNXBMFYSA-N |
| XLogP | 3.90 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|