C27H33ClN2O4 — CID 87368479
2-methylpropyl N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]carbamate;hydrochloride (PubChem CID 87368479) has the molecular formula C27H33ClN2O4 and a molecular weight of 485.02 g/mol. Its IUPAC name is 2-methylpropyl N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]carbamate;hydrochloride.
| Compound Name | 2-methylpropyl N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 87368479 |
| Molecular Formula | C27H33ClN2O4 |
| Molecular Weight | 485.02 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 2-methylpropyl N-[(13aS)-6,7-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-3-yl]carbamate;hydrochloride |
| SMILES | COc1cc2c3c(c4ccc(NC(=O)OCC(C)C)cc4c2cc1OC)C[C@@H]1CCCN1C3.Cl |
| InChI | InChI=1S/C27H32N2O4.ClH/c1-16(2)15-33-27(30)28-17-7-8-19-20(10-17)22-12-25(31-3)26(32-4)13-23(22)24-14-29-9-5-6-18(29)11-21(19)24;/h7-8,10,12-13,16,18H,5-6,9,11,14-15H2,1-4H3,(H,28,30);1H/t18-;/m0./s1 |
| InChIKey | GNXPJXMLPWGIDH-FERBBOLQSA-N |
| XLogP | 6.16 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.02 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|