C24H26N2O5S — CID 142738262
6-(methanesulfonamido)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[10,9-b]quinolizine-3-carboxylic acid (PubChem CID 142738262) has the molecular formula C24H26N2O5S and a molecular weight of 454.55 g/mol. Its IUPAC name is 6-(methanesulfonamido)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[10,9-b]quinolizine-3-carboxylic acid.
| Compound Name | 6-(methanesulfonamido)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[10,9-b]quinolizine-3-carboxylic acid |
|---|---|
| PubChem CID | 142738262 |
| Molecular Formula | C24H26N2O5S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 6-(methanesulfonamido)-2-methoxy-11,12,13,14,14a,15-hexahydro-9H-phenanthro[10,9-b]quinolizine-3-carboxylic acid |
| SMILES | COc1cc2c3c(c4ccc(NS(C)(=O)=O)cc4c2cc1C(=O)O)CN1CCCCC1C3 |
| InChI | InChI=1S/C24H26N2O5S/c1-31-23-12-20-18-10-15-5-3-4-8-26(15)13-22(18)16-7-6-14(25-32(2,29)30)9-17(16)19(20)11-21(23)24(27)28/h6-7,9,11-12,15,25H,3-5,8,10,13H2,1-2H3,(H,27,28) |
| InChIKey | XWTTUBNBZGSMTK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|