C23H25NO2 — CID 163852505
(13aS)-6,7-dimethoxy-3-methyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine (PubChem CID 163852505) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (13aS)-6,7-dimethoxy-3-methyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine.
| Compound Name | (13aS)-6,7-dimethoxy-3-methyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
|---|---|
| PubChem CID | 163852505 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (13aS)-6,7-dimethoxy-3-methyl-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine |
| SMILES | COc1cc2c3c(c4ccc(C)cc4c2cc1OC)C[C@@H]1CCCN1C3 |
| InChI | InChI=1S/C23H25NO2/c1-14-6-7-16-17(9-14)19-11-22(25-2)23(26-3)12-20(19)21-13-24-8-4-5-15(24)10-18(16)21/h6-7,9,11-12,15H,4-5,8,10,13H2,1-3H3/t15-/m0/s1 |
| InChIKey | OVOANUIWPSOVSL-HNNXBMFYSA-N |
| XLogP | 4.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|