C33H36N2O5 — CID 162643637
2-[[(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]oxy]ethyl (2S)-2-amino-3-phenylpropanoate (PubChem CID 162643637) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is 2-[[(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]oxy]ethyl (2S)-2-amino-3-phenylpropanoate.
| Compound Name | 2-[[(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]oxy]ethyl (2S)-2-amino-3-phenylpropanoate |
|---|---|
| PubChem CID | 162643637 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | 2-[[(13aR)-2,3-dimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[10,9-f]indolizin-6-yl]oxy]ethyl (2S)-2-amino-3-phenylpropanoate |
| SMILES | COc1cc2c3c(c4ccc(OCCOC(=O)[C@@H](N)Cc5ccccc5)cc4c2cc1OC)CN1CCC[C@@H]1C3 |
| InChI | InChI=1S/C33H36N2O5/c1-37-31-18-27-25-16-22-9-6-12-35(22)20-29(25)24-11-10-23(17-26(24)28(27)19-32(31)38-2)39-13-14-40-33(36)30(34)15-21-7-4-3-5-8-21/h3-5,7-8,10-11,17-19,22,30H,6,9,12-16,20,34H2,1-2H3/t22-,30+/m1/s1 |
| InChIKey | JFBXMBPDQZAQLR-RCRUUEGKSA-N |
| XLogP | 5.02 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|