C29H30N2O3 — CID 53386926
(21S)-4,5,10-trimethoxy-18-phenyl-16,18-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(14),2,4,6,8(13),9,11-heptaene (PubChem CID 53386926) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is (21S)-4,5,10-trimethoxy-18-phenyl-16,18-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(14),2,4,6,8(13),9,11-heptaene.
| Compound Name | (21S)-4,5,10-trimethoxy-18-phenyl-16,18-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(14),2,4,6,8(13),9,11-heptaene |
|---|---|
| PubChem CID | 53386926 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (21S)-4,5,10-trimethoxy-18-phenyl-16,18-diazapentacyclo[12.8.0.02,7.08,13.016,21]docosa-1(14),2,4,6,8(13),9,11-heptaene |
| SMILES | COc1ccc2c3c(c4cc(OC)c(OC)cc4c2c1)C[C@H]1CCN(c2ccccc2)CN1C3 |
| InChI | InChI=1S/C29H30N2O3/c1-32-21-9-10-22-24(14-21)26-16-29(34-3)28(33-2)15-25(26)23-13-20-11-12-30(18-31(20)17-27(22)23)19-7-5-4-6-8-19/h4-10,14-16,20H,11-13,17-18H2,1-3H3/t20-/m1/s1 |
| InChIKey | JXJIRFNHRZYNGM-HXUWFJFHSA-N |
| XLogP | 5.61 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|