C23H23NO3 — CID 89085736
(13aS)-6-(hydroxymethyl)-7-methoxy-3-methyl-12,13,13a,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-11-one (PubChem CID 89085736) has the molecular formula C23H23NO3 and a molecular weight of 361.44 g/mol. Its IUPAC name is (13aS)-6-(hydroxymethyl)-7-methoxy-3-methyl-12,13,13a,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-11-one.
| Compound Name | (13aS)-6-(hydroxymethyl)-7-methoxy-3-methyl-12,13,13a,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-11-one |
|---|---|
| PubChem CID | 89085736 |
| Molecular Formula | C23H23NO3 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | (13aS)-6-(hydroxymethyl)-7-methoxy-3-methyl-12,13,13a,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-11-one |
| SMILES | COc1cc2c3c(c4ccc(C)cc4c2cc1CO)C[C@@H]1CCC(=O)N1C3 |
| InChI | InChI=1S/C23H23NO3/c1-13-3-5-16-17(7-13)18-8-14(12-25)22(27-2)10-20(18)21-11-24-15(9-19(16)21)4-6-23(24)26/h3,5,7-8,10,15,25H,4,6,9,11-12H2,1-2H3/t15-/m0/s1 |
| InChIKey | IIXTVJHULBNIHH-HNNXBMFYSA-N |
| XLogP | 3.85 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|