C22H18FNO4 — CID 163640797
3-fluoro-6,7-dimethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione (PubChem CID 163640797) has the molecular formula C22H18FNO4 and a molecular weight of 379.39 g/mol. Its IUPAC name is 3-fluoro-6,7-dimethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione.
| Compound Name | 3-fluoro-6,7-dimethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione |
|---|---|
| PubChem CID | 163640797 |
| Molecular Formula | C22H18FNO4 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 3-fluoro-6,7-dimethoxy-9,12,13,13a-tetrahydrophenanthro[9,10-f]indolizine-11,14-dione |
| SMILES | COc1cc2c3c(c4ccc(F)cc4c2cc1OC)C(=O)C1CCC(=O)N1C3 |
| InChI | InChI=1S/C22H18FNO4/c1-27-18-8-14-13-7-11(23)3-4-12(13)21-16(15(14)9-19(18)28-2)10-24-17(22(21)26)5-6-20(24)25/h3-4,7-9,17H,5-6,10H2,1-2H3 |
| InChIKey | IECAKNHOEULMKU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|