C14H15FN2O3 — CID 170566104
3-(5-fluoro-1,3-dihydroisoindol-2-yl)-1-methoxypiperidine-2,6-dione (PubChem CID 170566104) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is 3-(5-fluoro-1,3-dihydroisoindol-2-yl)-1-methoxypiperidine-2,6-dione.
| Compound Name | 3-(5-fluoro-1,3-dihydroisoindol-2-yl)-1-methoxypiperidine-2,6-dione |
|---|---|
| PubChem CID | 170566104 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3-(5-fluoro-1,3-dihydroisoindol-2-yl)-1-methoxypiperidine-2,6-dione |
| SMILES | CON1C(=O)CCC(N2Cc3ccc(F)cc3C2)C1=O |
| InChI | InChI=1S/C14H15FN2O3/c1-20-17-13(18)5-4-12(14(17)19)16-7-9-2-3-11(15)6-10(9)8-16/h2-3,6,12H,4-5,7-8H2,1H3 |
| InChIKey | KWPBDMJUTJWDEA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|