C14H17N3O2 — CID 171058791
3-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 171058791) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171058791 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3-[5-(aminomethyl)-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H17N3O2/c15-6-9-1-2-10-7-17(8-11(10)5-9)12-3-4-13(18)16-14(12)19/h1-2,5,12H,3-4,6-8,15H2,(H,16,18,19) |
| InChIKey | VHQHBUKFDCZNOG-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|