C21H30N4O3 — CID 175906497
3-[5-[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione (PubChem CID 175906497) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 3-[5-[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 175906497 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 3-[5-[[4-(3-hydroxypropyl)piperazin-1-yl]methyl]-1,3-dihydroisoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CN4CCN(CCCO)CC4)cc3C2)C(=O)N1 |
| InChI | InChI=1S/C21H30N4O3/c26-11-1-6-23-7-9-24(10-8-23)13-16-2-3-17-14-25(15-18(17)12-16)19-4-5-20(27)22-21(19)28/h2-3,12,19,26H,1,4-11,13-15H2,(H,22,27,28) |
| InChIKey | WYXNQJIXEZFCMK-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 76.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|