C23H33N5O3 — CID 167730458
3-[5-[[4-(5-aminopentyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167730458) has the molecular formula C23H33N5O3 and a molecular weight of 427.55 g/mol. Its IUPAC name is 3-[5-[[4-(5-aminopentyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[[4-(5-aminopentyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167730458 |
| Molecular Formula | C23H33N5O3 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | 3-[5-[[4-(5-aminopentyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCCCCCN1CCN(Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C23H33N5O3/c24-8-2-1-3-9-26-10-12-27(13-11-26)15-17-4-5-18-16-28(23(31)19(18)14-17)20-6-7-21(29)25-22(20)30/h4-5,14,20H,1-3,6-13,15-16,24H2,(H,25,29,30) |
| InChIKey | MPELLRMIWLSFBV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|