C26H39N5O3 — CID 167731550
3-[4-[[4-(8-aminooctyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167731550) has the molecular formula C26H39N5O3 and a molecular weight of 469.63 g/mol. Its IUPAC name is 3-[4-[[4-(8-aminooctyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[[4-(8-aminooctyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167731550 |
| Molecular Formula | C26H39N5O3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.31 |
| IUPAC Name | 3-[4-[[4-(8-aminooctyl)piperazin-1-yl]methyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCCCCCCCCN1CCN(Cc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3)CC1 |
| InChI | InChI=1S/C26H39N5O3/c27-12-5-3-1-2-4-6-13-29-14-16-30(17-15-29)18-20-8-7-9-21-19-31(26(34)24(20)21)22-10-11-23(32)28-25(22)33/h7-9,22H,1-6,10-19,27H2,(H,28,32,33) |
| InChIKey | MWJAXPSRCHDNDJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 98.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|