C28H40N6O3 — CID 167729264
3-[3-oxo-4-[[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167729264) has the molecular formula C28H40N6O3 and a molecular weight of 508.67 g/mol. Its IUPAC name is 3-[3-oxo-4-[[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-4-[[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167729264 |
| Molecular Formula | C28H40N6O3 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | 3-[3-oxo-4-[[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]methyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cccc(CN4CCN(C5CCN(C6CCNCC6)CC5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H40N6O3/c35-25-5-4-24(27(36)30-25)34-19-21-3-1-2-20(26(21)28(34)37)18-31-14-16-33(17-15-31)23-8-12-32(13-9-23)22-6-10-29-11-7-22/h1-3,22-24,29H,4-19H2,(H,30,35,36) |
| InChIKey | SNDHXQJXAWNFSX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|