C22H26N6O3 — CID 167724876
3-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methyl]piperazin-1-yl]azetidine-3-carbonitrile (PubChem CID 167724876) has the molecular formula C22H26N6O3 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methyl]piperazin-1-yl]azetidine-3-carbonitrile.
| Compound Name | 3-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methyl]piperazin-1-yl]azetidine-3-carbonitrile |
|---|---|
| PubChem CID | 167724876 |
| Molecular Formula | C22H26N6O3 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 3-[4-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]methyl]piperazin-1-yl]azetidine-3-carbonitrile |
| SMILES | N#CC1(N2CCN(Cc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4)CC2)CNC1 |
| InChI | InChI=1S/C22H26N6O3/c23-12-22(13-24-14-22)27-8-6-26(7-9-27)10-15-2-1-3-16-11-28(21(31)19(15)16)17-4-5-18(29)25-20(17)30/h1-3,17,24H,4-11,13-14H2,(H,25,29,30) |
| InChIKey | ZLSAWTBAOSHNMM-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|